C25H27F4Y- — CID 59931299
2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;yttrium (PubChem CID 59931299) has the molecular formula C25H27F4Y- and a molecular weight of 492.39 g/mol. Its IUPAC name is 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;yttrium.
| Compound Name | 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;yttrium |
|---|---|
| PubChem CID | 59931299 |
| Molecular Formula | C25H27F4Y- |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;yttrium |
| SMILES | CC1CCC(C2CCC(c3cc(F)c(-c4cc(F)[c-]c(F)c4)c(F)c3)CC2)CC1.[Y] |
| InChI | InChI=1S/C25H27F4.Y/c1-15-2-4-16(5-3-15)17-6-8-18(9-7-17)19-12-23(28)25(24(29)13-19)20-10-21(26)14-22(27)11-20;/h10-13,15-18H,2-9H2,1H3;/q-1; |
| InChIKey | OSQJGSKXIZOKCN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|