C19H20F2 — CID 18720868
1,3-difluoro-5-(4-methylcyclohexyl)-2-phenylbenzene (PubChem CID 18720868) has the molecular formula C19H20F2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-methylcyclohexyl)-2-phenylbenzene.
| Compound Name | 1,3-difluoro-5-(4-methylcyclohexyl)-2-phenylbenzene |
|---|---|
| PubChem CID | 18720868 |
| Molecular Formula | C19H20F2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1,3-difluoro-5-(4-methylcyclohexyl)-2-phenylbenzene |
| SMILES | CC1CCC(c2cc(F)c(-c3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C19H20F2/c1-13-7-9-14(10-8-13)16-11-17(20)19(18(21)12-16)15-5-3-2-4-6-15/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | QGOXBKANYAACFU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |