C25H30F2 — CID 20808978
(2R,4aR,8aR)-2-[4-(4-ethylphenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808978) has the molecular formula C25H30F2 and a molecular weight of 368.51 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-ethylphenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-ethylphenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808978 |
| Molecular Formula | C25H30F2 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-ethylphenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCc1ccc(-c2c(F)cc([C@@H]3CC[C@@H]4CC(C)CC[C@@H]4C3)cc2F)cc1 |
| InChI | InChI=1S/C25H30F2/c1-3-17-5-8-18(9-6-17)25-23(26)14-22(15-24(25)27)21-11-10-19-12-16(2)4-7-20(19)13-21/h5-6,8-9,14-16,19-21H,3-4,7,10-13H2,1-2H3/t16?,19-,20-,21-/m1/s1 |
| InChIKey | KBNGZPQPBVRMAZ-QWZZGZKDSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |