C26H30F4 — CID 22383401
2-butyl-6-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22383401) has the molecular formula C26H30F4 and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-butyl-6-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-butyl-6-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22383401 |
| Molecular Formula | C26H30F4 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-butyl-6-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCC1CCC2CC(c3cc(F)c(-c4ccc(F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C26H30F4/c1-2-3-4-16-5-6-18-12-19(8-7-17(18)11-16)21-14-24(29)26(25(30)15-21)20-9-10-22(27)23(28)13-20/h9-10,13-19H,2-8,11-12H2,1H3 |
| InChIKey | KUCFMPHBMICYDU-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |