C23H24F4 — CID 22382914
2-[4-(3,5-difluorophenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22382914) has the molecular formula C23H24F4 and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[4-(3,5-difluorophenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-(3,5-difluorophenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22382914 |
| Molecular Formula | C23H24F4 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[4-(3,5-difluorophenyl)-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CC(c3cc(F)c(-c4cc(F)cc(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C23H24F4/c1-13-2-3-15-7-16(5-4-14(15)6-13)17-10-21(26)23(22(27)11-17)18-8-19(24)12-20(25)9-18/h8-16H,2-7H2,1H3 |
| InChIKey | TWCAYOIVQNOEMQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |