C24H25F5O — CID 20808922
(2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808922) has the molecular formula C24H25F5O and a molecular weight of 424.45 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808922 |
| Molecular Formula | C24H25F5O |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CC[C@@H]2C[C@H](c3cc(F)c(-c4ccc(OC(F)F)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C24H25F5O/c1-13-2-3-15-9-16(5-4-14(15)8-13)18-11-20(26)23(21(27)12-18)17-6-7-22(19(25)10-17)30-24(28)29/h6-7,10-16,24H,2-5,8-9H2,1H3/t13?,14-,15-,16-/m1/s1 |
| InChIKey | YRNSGRHSSSXHJT-VZMGZUMBSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |