C25H27F5O — CID 20808919
(2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808919) has the molecular formula C25H27F5O and a molecular weight of 438.48 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808919 |
| Molecular Formula | C25H27F5O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3cc(F)c(-c4ccc(OC(F)F)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C25H27F5O/c1-2-14-3-4-16-10-17(6-5-15(16)9-14)19-12-21(27)24(22(28)13-19)18-7-8-23(20(26)11-18)31-25(29)30/h7-8,11-17,25H,2-6,9-10H2,1H3/t14?,15-,16-,17-/m1/s1 |
| InChIKey | JGGFNFVRJCARJI-XMMHPARDSA-N |
| XLogP | 8.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |