C34H37F7O — CID 22080455
2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene (PubChem CID 22080455) has the molecular formula C34H37F7O and a molecular weight of 594.66 g/mol. Its IUPAC name is 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene.
| Compound Name | 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 22080455 |
| Molecular Formula | C34H37F7O |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-fluoro-1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene |
| SMILES | CCCCCc1ccc(C2CCC(CCc3ccc(-c4ccc(OC(F)(F)C(F)C(F)(F)F)c(F)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H37F7O/c1-2-3-4-5-23-8-14-26(15-9-23)27-16-10-24(11-17-27)6-7-25-12-18-28(19-13-25)29-20-21-31(30(35)22-29)42-34(40,41)32(36)33(37,38)39/h8-9,12-15,18-22,24,27,32H,2-7,10-11,16-17H2,1H3 |
| InChIKey | WLPSENHRKRFHBN-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|