C7H2BrClF4O — CID 71669494
1-bromo-4-[chloro(difluoro)methoxy]-2,3-difluorobenzene (PubChem CID 71669494) has the molecular formula C7H2BrClF4O and a molecular weight of 293.44 g/mol. Its IUPAC name is 1-bromo-4-[chloro(difluoro)methoxy]-2,3-difluorobenzene.
| Compound Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 71669494 |
| Molecular Formula | C7H2BrClF4O |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 291.89 |
| IUPAC Name | 1-bromo-4-[chloro(difluoro)methoxy]-2,3-difluorobenzene |
| SMILES | Fc1c(Br)ccc(OC(F)(F)Cl)c1F |
| InChI | InChI=1S/C7H2BrClF4O/c8-3-1-2-4(6(11)5(3)10)14-7(9,12)13/h1-2H |
| InChIKey | UCVVKIRKVHNFTD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|