C9H6BrClF4OS — CID 164578579
1-bromo-2-chloro-3-methylsulfanyl-4-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 164578579) has the molecular formula C9H6BrClF4OS and a molecular weight of 353.56 g/mol. Its IUPAC name is 1-bromo-2-chloro-3-methylsulfanyl-4-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-bromo-2-chloro-3-methylsulfanyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 164578579 |
| Molecular Formula | C9H6BrClF4OS |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 1-bromo-2-chloro-3-methylsulfanyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CSc1c(OC(F)(F)C(F)F)ccc(Br)c1Cl |
| InChI | InChI=1S/C9H6BrClF4OS/c1-17-7-5(3-2-4(10)6(7)11)16-9(14,15)8(12)13/h2-3,8H,1H3 |
| InChIKey | HGRJGTPBWLCDTR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|