C9H9BrF2O — CID 125116613
1-bromo-2,3-difluoro-4-propan-2-yloxybenzene (PubChem CID 125116613) has the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. Its IUPAC name is 1-bromo-2,3-difluoro-4-propan-2-yloxybenzene.
| Compound Name | 1-bromo-2,3-difluoro-4-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 125116613 |
| Molecular Formula | C9H9BrF2O |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 1-bromo-2,3-difluoro-4-propan-2-yloxybenzene |
| SMILES | CC(C)Oc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C9H9BrF2O/c1-5(2)13-7-4-3-6(10)8(11)9(7)12/h3-5H,1-2H3 |
| InChIKey | UWISUSMHGTYZFD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|