C31H3BF21- — CID 101101216
tris(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-methylboranuide (PubChem CID 101101216) has the molecular formula C31H3BF21- and a molecular weight of 785.13 g/mol. Its IUPAC name is tris(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-methylboranuide.
| Compound Name | tris(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-methylboranuide |
|---|---|
| PubChem CID | 101101216 |
| Molecular Formula | C31H3BF21- |
| Molecular Weight | 785.13 g/mol |
| Exact Mass | 785.00 |
| IUPAC Name | tris(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-methylboranuide |
| SMILES | C[B-](c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12)(c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C31H3BF21/c1-32(8-2-5(14(36)23(45)20(8)42)17(39)29(51)26(48)11(2)33,9-3-6(15(37)24(46)21(9)43)18(40)30(52)27(49)12(3)34)10-4-7(16(38)25(47)22(10)44)19(41)31(53)28(50)13(4)35/h1H3/q-1 |
| InChIKey | IDUJOJAGJFYKJB-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.13 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|