C20H7BF15N — CID 5251562
(dimethylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 5251562) has the molecular formula C20H7BF15N and a molecular weight of 557.07 g/mol. Its IUPAC name is (dimethylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (dimethylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 5251562 |
| Molecular Formula | C20H7BF15N |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | (dimethylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[NH+](C)[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H7BF15N/c1-37(2)21(3-6(22)12(28)18(34)13(29)7(3)23,4-8(24)14(30)19(35)15(31)9(4)25)5-10(26)16(32)20(36)17(33)11(5)27/h37H,1-2H3 |
| InChIKey | QQCOGGDNIUXEQP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|