C12BCl2F10- — CID 139101899
dichloro-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139101899) has the molecular formula C12BCl2F10- and a molecular weight of 415.83 g/mol. Its IUPAC name is dichloro-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dichloro-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139101899 |
| Molecular Formula | C12BCl2F10- |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | dichloro-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](Cl)(Cl)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12BCl2F10/c14-13(15,1-3(16)7(20)11(24)8(21)4(1)17)2-5(18)9(22)12(25)10(23)6(2)19/q-1 |
| InChIKey | LLLKWHKDQJKFKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|