C38B2F30N3- — CID 102468820
tris(2,3,4,5,6-pentafluorophenyl)-[tris(2,3,4,5,6-pentafluorophenyl)boranuidyliminomethylideneazaniumylidenemethylideneamino]boranuide (PubChem CID 102468820) has the molecular formula C38B2F30N3- and a molecular weight of 1090.00 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-[tris(2,3,4,5,6-pentafluorophenyl)boranuidyliminomethylideneazaniumylidenemethylideneamino]boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-[tris(2,3,4,5,6-pentafluorophenyl)boranuidyliminomethylideneazaniumylidenemethylideneamino]boranuide |
|---|---|
| PubChem CID | 102468820 |
| Molecular Formula | C38B2F30N3- |
| Molecular Weight | 1090.00 g/mol |
| Exact Mass | 1089.98 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-[tris(2,3,4,5,6-pentafluorophenyl)boranuidyliminomethylideneazaniumylidenemethylideneamino]boranuide |
| SMILES | Fc1c(F)c(F)c([B-](N=C=[N+]=C=N[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C38B2F30N3/c41-9-3(10(42)22(54)33(65)21(9)53)39(4-11(43)23(55)34(66)24(56)12(4)44,5-13(45)25(57)35(67)26(58)14(5)46)72-1-71-2-73-40(6-15(47)27(59)36(68)28(60)16(6)48,7-17(49)29(61)37(69)30(62)18(7)50)8-19(51)31(63)38(70)32(64)20(8)52/q-1 |
| InChIKey | SONUXIJYNGCHMP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 38.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.00 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|