C26H7BF15N — CID 100963419
tris(2,3,4,5,6-pentafluorophenyl)-(2-phenylethylidyneazaniumyl)boranuide (PubChem CID 100963419) has the molecular formula C26H7BF15N and a molecular weight of 629.13 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(2-phenylethylidyneazaniumyl)boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(2-phenylethylidyneazaniumyl)boranuide |
|---|---|
| PubChem CID | 100963419 |
| Molecular Formula | C26H7BF15N |
| Molecular Weight | 629.13 g/mol |
| Exact Mass | 629.04 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(2-phenylethylidyneazaniumyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-]([N+]#CCc2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C26H7BF15N/c28-12-9(13(29)19(35)24(40)18(12)34)27(43-7-6-8-4-2-1-3-5-8,10-14(30)20(36)25(41)21(37)15(10)31)11-16(32)22(38)26(42)23(39)17(11)33/h1-5H,6H2 |
| InChIKey | OEZQOIOUMGWHKR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.13 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|