C25H7F15Pb — CID 134904859
benzyl-tris(2,3,4,5,6-pentafluorophenyl)plumbane (PubChem CID 134904859) has the molecular formula C25H7F15Pb and a molecular weight of 799.50 g/mol. Its IUPAC name is benzyl-tris(2,3,4,5,6-pentafluorophenyl)plumbane.
| Compound Name | benzyl-tris(2,3,4,5,6-pentafluorophenyl)plumbane |
|---|---|
| PubChem CID | 134904859 |
| Molecular Formula | C25H7F15Pb |
| Molecular Weight | 799.50 g/mol |
| Exact Mass | 800.01 |
| IUPAC Name | benzyl-tris(2,3,4,5,6-pentafluorophenyl)plumbane |
| SMILES | Fc1c(F)c(F)c([Pb](Cc2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C7H7.3C6F5.Pb/c1-7-5-3-2-4-6-7;3*7-2-1-3(8)5(10)6(11)4(2)9;/h2-6H,1H2;;;; |
| InChIKey | FFIJEZRVWSGZSQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|