C14H9F5O — CID 10684746
(1R)-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethanol (PubChem CID 10684746) has the molecular formula C14H9F5O and a molecular weight of 288.21 g/mol. Its IUPAC name is (1R)-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethanol.
| Compound Name | (1R)-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethanol |
|---|---|
| PubChem CID | 10684746 |
| Molecular Formula | C14H9F5O |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (1R)-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethanol |
| SMILES | O[C@H](Cc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H9F5O/c15-10-9(11(16)13(18)14(19)12(10)17)8(20)6-7-4-2-1-3-5-7/h1-5,8,20H,6H2/t8-/m1/s1 |
| InChIKey | ZGOBGMUNZUGLEY-MRVPVSSYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|