C15H13F4NO — CID 171269901
(1S,2R)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol (PubChem CID 171269901) has the molecular formula C15H13F4NO and a molecular weight of 299.27 g/mol. Its IUPAC name is (1S,2R)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 171269901 |
| Molecular Formula | C15H13F4NO |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (1S,2R)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol |
| SMILES | N[C@@H](c1c(F)c(F)cc(F)c1F)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H13F4NO/c16-9-7-10(17)14(19)12(13(9)18)15(20)11(21)6-8-4-2-1-3-5-8/h1-5,7,11,15,21H,6,20H2/t11-,15-/m1/s1 |
| InChIKey | UFIBTZKWMSXJBN-IAQYHMDHSA-N |
| XLogP | 2.85 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|