C15H14ClF4NO — CID 171264227
(1R,2S)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol;hydrochloride (PubChem CID 171264227) has the molecular formula C15H14ClF4NO and a molecular weight of 335.73 g/mol. Its IUPAC name is (1R,2S)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171264227 |
| Molecular Formula | C15H14ClF4NO |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (1R,2S)-1-amino-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1c(F)c(F)cc(F)c1F)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H13F4NO.ClH/c16-9-7-10(17)14(19)12(13(9)18)15(20)11(21)6-8-4-2-1-3-5-8;/h1-5,7,11,15,21H,6,20H2;1H/t11-,15-;/m0./s1 |
| InChIKey | DYCTYSLSKVBSBM-JDOFTSHGSA-N |
| XLogP | 3.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|