C25H9BF15N — CID 139129604
(benzylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139129604) has the molecular formula C25H9BF15N and a molecular weight of 619.14 g/mol. Its IUPAC name is (benzylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (benzylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139129604 |
| Molecular Formula | C25H9BF15N |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 619.06 |
| IUPAC Name | (benzylazaniumyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-]([NH2+]Cc2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H9BF15N/c27-11-8(12(28)18(34)23(39)17(11)33)26(42-6-7-4-2-1-3-5-7,9-13(29)19(35)24(40)20(36)14(9)30)10-15(31)21(37)25(41)22(38)16(10)32/h1-5H,6,42H2 |
| InChIKey | ODQJXHDVBWZLAH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|