About dibenzylazanium iodide
dibenzylazanium iodide (PubChem CID 15533239) has the molecular formula C14H16IN
and a molecular weight of 325.19 g/mol. Its IUPAC name is dibenzylazanium iodide.
Molecular Properties
| Compound Name | dibenzylazanium iodide |
| PubChem CID | 15533239 |
| Molecular Formula | C14H16IN |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | dibenzylazanium iodide |
| SMILES | [I-].c1ccc(C[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.HI/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;/h1-10,15H,11-12H2;1H |
| InChIKey | XCKSUTIMJQZUHJ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dibenzylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylazanium iodide?
The IUPAC name of dibenzylazanium iodide (CID 15533239) is dibenzylazanium iodide.
What is the SMILES notation for dibenzylazanium iodide?
The canonical SMILES for dibenzylazanium iodide is [I-].c1ccc(C[NH2+]Cc2ccccc2)cc1.
What is the InChIKey of dibenzylazanium iodide?
The InChIKey is XCKSUTIMJQZUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.HI/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;/h1-10,15H,11-12H2;1H.
What are the key properties of dibenzylazanium iodide?
dibenzylazanium iodide has a molecular weight of 325.19 g/mol, XLogP of -1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylazanium iodide is sourced from PubChem (CID 15533239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).