About dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane
dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 18529115) has the molecular formula C14H16F2NPS2
and a molecular weight of 331.39 g/mol. Its IUPAC name is dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane.
Molecular Properties
| Compound Name | dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane |
| PubChem CID | 18529115 |
| Molecular Formula | C14H16F2NPS2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | FP(F)(=S)[S-].c1ccc(C[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.F2HPS2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-3(2,4)5/h1-10,15H,11-12H2;(H,4,5) |
| InChIKey | UDIBYOUYNXOBHJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane?
The IUPAC name of dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane (CID 18529115) is dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane.
What is the SMILES notation for dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane?
The canonical SMILES for dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane is FP(F)(=S)[S-].c1ccc(C[NH2+]Cc2ccccc2)cc1.
What is the InChIKey of dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane?
The InChIKey is UDIBYOUYNXOBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.F2HPS2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-3(2,4)5/h1-10,15H,11-12H2;(H,4,5).
What are the key properties of dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane?
dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane has a molecular weight of 331.39 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylazanium;difluoro-sulfanylidene-sulfido-λ5-phosphane is sourced from PubChem (CID 18529115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).