About benzyl(butyl)azanium fluoride
benzyl(butyl)azanium fluoride (PubChem CID 161148971) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is benzyl(butyl)azanium fluoride.
Molecular Properties
| Compound Name | benzyl(butyl)azanium fluoride |
| PubChem CID | 161148971 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | benzyl(butyl)azanium fluoride |
| SMILES | CCCC[NH2+]Cc1ccccc1.[F-] |
| InChI | InChI=1S/C11H17N.FH/c1-2-3-9-12-10-11-7-5-4-6-8-11;/h4-8,12H,2-3,9-10H2,1H3;1H |
| InChIKey | UOKOGOFRRSEJCL-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl(butyl)azanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(butyl)azanium fluoride?
The IUPAC name of benzyl(butyl)azanium fluoride (CID 161148971) is benzyl(butyl)azanium fluoride.
What is the SMILES notation for benzyl(butyl)azanium fluoride?
The canonical SMILES for benzyl(butyl)azanium fluoride is CCCC[NH2+]Cc1ccccc1.[F-].
What is the InChIKey of benzyl(butyl)azanium fluoride?
The InChIKey is UOKOGOFRRSEJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.FH/c1-2-3-9-12-10-11-7-5-4-6-8-11;/h4-8,12H,2-3,9-10H2,1H3;1H.
What are the key properties of benzyl(butyl)azanium fluoride?
benzyl(butyl)azanium fluoride has a molecular weight of 183.27 g/mol, XLogP of -1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(butyl)azanium fluoride is sourced from PubChem (CID 161148971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).