C22H25N2O+ — CID 9263274
3-hydroxypropyl-[[4-(N-phenylanilino)phenyl]methyl]azanium (PubChem CID 9263274) has the molecular formula C22H25N2O+ and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-hydroxypropyl-[[4-(N-phenylanilino)phenyl]methyl]azanium.
| Compound Name | 3-hydroxypropyl-[[4-(N-phenylanilino)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9263274 |
| Molecular Formula | C22H25N2O+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 3-hydroxypropyl-[[4-(N-phenylanilino)phenyl]methyl]azanium |
| SMILES | OCCC[NH2+]Cc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O/c25-17-7-16-23-18-19-12-14-22(15-13-19)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-15,23,25H,7,16-18H2/p+1 |
| InChIKey | XDBUTLHMCHHUGS-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|