C48H48N3+3 — CID 101337215
benzyl-[[4-[3,5-bis[4-[(benzylazaniumyl)methyl]phenyl]phenyl]phenyl]methyl]azanium (PubChem CID 101337215) has the molecular formula C48H48N3+3 and a molecular weight of 666.93 g/mol. Its IUPAC name is benzyl-[[4-[3,5-bis[4-[(benzylazaniumyl)methyl]phenyl]phenyl]phenyl]methyl]azanium.
| Compound Name | benzyl-[[4-[3,5-bis[4-[(benzylazaniumyl)methyl]phenyl]phenyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 101337215 |
| Molecular Formula | C48H48N3+3 |
| Molecular Weight | 666.93 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | benzyl-[[4-[3,5-bis[4-[(benzylazaniumyl)methyl]phenyl]phenyl]phenyl]methyl]azanium |
| SMILES | c1ccc(C[NH2+]Cc2ccc(-c3cc(-c4ccc(C[NH2+]Cc5ccccc5)cc4)cc(-c4ccc(C[NH2+]Cc5ccccc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C48H45N3/c1-4-10-37(11-5-1)31-49-34-40-16-22-43(23-17-40)46-28-47(44-24-18-41(19-25-44)35-50-32-38-12-6-2-7-13-38)30-48(29-46)45-26-20-42(21-27-45)36-51-33-39-14-8-3-9-15-39/h1-30,49-51H,31-36H2/p+3 |
| InChIKey | SXAJWRDGYFNBSU-UHFFFAOYSA-Q |
| XLogP | 7.48 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.93 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |