C14H20IN — CID 87531255
benzyl(hepta-1,6-dien-4-yl)azanium iodide (PubChem CID 87531255) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is benzyl(hepta-1,6-dien-4-yl)azanium iodide.
| Compound Name | benzyl(hepta-1,6-dien-4-yl)azanium iodide |
|---|---|
| PubChem CID | 87531255 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | benzyl(hepta-1,6-dien-4-yl)azanium iodide |
| SMILES | C=CCC(CC=C)[NH2+]Cc1ccccc1.[I-] |
| InChI | InChI=1S/C14H19N.HI/c1-3-8-14(9-4-2)15-12-13-10-6-5-7-11-13;/h3-7,10-11,14-15H,1-2,8-9,12H2;1H |
| InChIKey | LZSYZLRTDVUNSZ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|