About benzyl-tris(prop-2-enyl)phosphanium;ethene
benzyl-tris(prop-2-enyl)phosphanium;ethene (PubChem CID 174788600) has the molecular formula C18H26P+
and a molecular weight of 273.38 g/mol. Its IUPAC name is benzyl-tris(prop-2-enyl)phosphanium;ethene.
Molecular Properties
| Compound Name | benzyl-tris(prop-2-enyl)phosphanium;ethene |
| PubChem CID | 174788600 |
| Molecular Formula | C18H26P+ |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | benzyl-tris(prop-2-enyl)phosphanium;ethene |
| SMILES | C=C.C=CC[P+](CC=C)(CC=C)Cc1ccccc1 |
| InChI | InChI=1S/C16H22P.C2H4/c1-4-12-17(13-5-2,14-6-3)15-16-10-8-7-9-11-16;1-2/h4-11H,1-3,12-15H2;1-2H2/q+1; |
| InChIKey | FZTYBJRNECSWED-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl-tris(prop-2-enyl)phosphanium;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-tris(prop-2-enyl)phosphanium;ethene?
The IUPAC name of benzyl-tris(prop-2-enyl)phosphanium;ethene (CID 174788600) is benzyl-tris(prop-2-enyl)phosphanium;ethene.
What is the SMILES notation for benzyl-tris(prop-2-enyl)phosphanium;ethene?
The canonical SMILES for benzyl-tris(prop-2-enyl)phosphanium;ethene is C=C.C=CC[P+](CC=C)(CC=C)Cc1ccccc1.
What is the InChIKey of benzyl-tris(prop-2-enyl)phosphanium;ethene?
The InChIKey is FZTYBJRNECSWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22P.C2H4/c1-4-12-17(13-5-2,14-6-3)15-16-10-8-7-9-11-16;1-2/h4-11H,1-3,12-15H2;1-2H2/q+1;.
What are the key properties of benzyl-tris(prop-2-enyl)phosphanium;ethene?
benzyl-tris(prop-2-enyl)phosphanium;ethene has a molecular weight of 273.38 g/mol, XLogP of 5.56, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-tris(prop-2-enyl)phosphanium;ethene is sourced from PubChem (CID 174788600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).