About azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide
azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide (PubChem CID 174799231) has the molecular formula C30H58BrNP+
and a molecular weight of 543.68 g/mol. Its IUPAC name is azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide.
Molecular Properties
| Compound Name | azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide |
| PubChem CID | 174799231 |
| Molecular Formula | C30H58BrNP+ |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide |
| SMILES | Br.C=CC[P+](CCCCCCCCCC)(CCCCCCCCCC)Cc1ccccc1.N |
| InChI | InChI=1S/C30H54P.BrH.H3N/c1-4-7-9-11-13-15-17-22-27-31(26-6-3,29-30-24-20-19-21-25-30)28-23-18-16-14-12-10-8-5-2;;/h6,19-21,24-25H,3-5,7-18,22-23,26-29H2,1-2H3;1H;1H3/q+1;; |
| InChIKey | ZGEROSJPGLCYBH-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide?
The IUPAC name of azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide (CID 174799231) is azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide.
What is the SMILES notation for azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide?
The canonical SMILES for azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide is Br.C=CC[P+](CCCCCCCCCC)(CCCCCCCCCC)Cc1ccccc1.N.
What is the InChIKey of azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide?
The InChIKey is ZGEROSJPGLCYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H54P.BrH.H3N/c1-4-7-9-11-13-15-17-22-27-31(26-6-3,29-30-24-20-19-21-25-30)28-23-18-16-14-12-10-8-5-2;;/h6,19-21,24-25H,3-5,7-18,22-23,26-29H2,1-2H3;1H;1H3/q+1;;.
What are the key properties of azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide?
azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide has a molecular weight of 543.68 g/mol, XLogP of 11.41, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzyl-didecyl-prop-2-enylphosphanium;hydrobromide is sourced from PubChem (CID 174799231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).