About nickel(2+);phenylmethanethiolate
nickel(2+);phenylmethanethiolate (PubChem CID 6098233) has the molecular formula C14H14NiS2
and a molecular weight of 305.09 g/mol. Its IUPAC name is nickel(2+);phenylmethanethiolate.
Molecular Properties
| Compound Name | nickel(2+);phenylmethanethiolate |
| PubChem CID | 6098233 |
| Molecular Formula | C14H14NiS2 |
| Molecular Weight | 305.09 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | nickel(2+);phenylmethanethiolate |
| SMILES | [Ni+2].[S-]Cc1ccccc1.[S-]Cc1ccccc1 |
| InChI | InChI=1S/2C7H8S.Ni/c2*8-6-7-4-2-1-3-5-7;/h2*1-5,8H,6H2;/q;;+2/p-2 |
| InChIKey | YNWGAWXSBJCMAC-UHFFFAOYSA-L |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.09 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);phenylmethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);phenylmethanethiolate?
The IUPAC name of nickel(2+);phenylmethanethiolate (CID 6098233) is nickel(2+);phenylmethanethiolate.
What is the SMILES notation for nickel(2+);phenylmethanethiolate?
The canonical SMILES for nickel(2+);phenylmethanethiolate is [Ni+2].[S-]Cc1ccccc1.[S-]Cc1ccccc1.
What is the InChIKey of nickel(2+);phenylmethanethiolate?
The InChIKey is YNWGAWXSBJCMAC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8S.Ni/c2*8-6-7-4-2-1-3-5-7;/h2*1-5,8H,6H2;/q;;+2/p-2.
What are the key properties of nickel(2+);phenylmethanethiolate?
nickel(2+);phenylmethanethiolate has a molecular weight of 305.09 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);phenylmethanethiolate is sourced from PubChem (CID 6098233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).