About chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene
chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene (PubChem CID 70538509) has the molecular formula C14H13Cl2F
and a molecular weight of 271.16 g/mol. Its IUPAC name is chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene.
Molecular Properties
| Compound Name | chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene |
| PubChem CID | 70538509 |
| Molecular Formula | C14H13Cl2F |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene |
| SMILES | ClCc1ccccc1.Fc1ccc(CCl)cc1 |
| InChI | InChI=1S/C7H6ClF.C7H7Cl/c8-5-6-1-3-7(9)4-2-6;8-6-7-4-2-1-3-5-7/h1-4H,5H2;1-5H,6H2 |
| InChIKey | YUMHSTIHPBAXJI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene?
The IUPAC name of chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene (CID 70538509) is chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene.
What is the SMILES notation for chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene?
The canonical SMILES for chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene is ClCc1ccccc1.Fc1ccc(CCl)cc1.
What is the InChIKey of chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene?
The InChIKey is YUMHSTIHPBAXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF.C7H7Cl/c8-5-6-1-3-7(9)4-2-6;8-6-7-4-2-1-3-5-7/h1-4H,5H2;1-5H,6H2.
What are the key properties of chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene?
chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene has a molecular weight of 271.16 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;1-(chloromethyl)-4-fluorobenzene is sourced from PubChem (CID 70538509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).