C21H2BF15N2 — CID 139096387
2-cyanoethylidyneazaniumyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139096387) has the molecular formula C21H2BF15N2 and a molecular weight of 578.04 g/mol. Its IUPAC name is 2-cyanoethylidyneazaniumyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-cyanoethylidyneazaniumyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139096387 |
| Molecular Formula | C21H2BF15N2 |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | 2-cyanoethylidyneazaniumyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | N#CCC#[N+][B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H2BF15N2/c23-7-4(8(24)14(30)19(35)13(7)29)22(39-3-1-2-38,5-9(25)15(31)20(36)16(32)10(5)26)6-11(27)17(33)21(37)18(34)12(6)28/h1H2 |
| InChIKey | SATVUCYNMLJTEU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|