C30H5BF20N2 — CID 22676427
pyridin-1-ium-4-carbonitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 22676427) has the molecular formula C30H5BF20N2 and a molecular weight of 784.16 g/mol. Its IUPAC name is pyridin-1-ium-4-carbonitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | pyridin-1-ium-4-carbonitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 22676427 |
| Molecular Formula | C30H5BF20N2 |
| Molecular Weight | 784.16 g/mol |
| Exact Mass | 784.02 |
| IUPAC Name | pyridin-1-ium-4-carbonitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.N#Cc1cc[nH+]cc1 |
| InChI | InChI=1S/C24BF20.C6H4N2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;7-5-6-1-3-8-4-2-6/h;1-4H/q-1;/p+1 |
| InChIKey | GPYUCSPMEKQLOS-UHFFFAOYSA-O |
| XLogP | 6.22 |
| TPSA | 37.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.16 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|