C37H13BF20N2S — CID 139727246
(3,3-dicyano-2-phenylprop-2-enyl)-dimethylsulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139727246) has the molecular formula C37H13BF20N2S and a molecular weight of 908.36 g/mol. Its IUPAC name is (3,3-dicyano-2-phenylprop-2-enyl)-dimethylsulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (3,3-dicyano-2-phenylprop-2-enyl)-dimethylsulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139727246 |
| Molecular Formula | C37H13BF20N2S |
| Molecular Weight | 908.36 g/mol |
| Exact Mass | 908.06 |
| IUPAC Name | (3,3-dicyano-2-phenylprop-2-enyl)-dimethylsulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[S+](C)CC(=C(C#N)C#N)c1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C13H13N2S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-16(2)10-13(12(8-14)9-15)11-6-4-3-5-7-11/h;3-7H,10H2,1-2H3/q-1;+1 |
| InChIKey | WMYTUYYVZOPEDN-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.36 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|