C35H10BF20N3 — CID 139732563
2-(1-pyridin-1-ium-1-ylpropan-2-ylidene)propanedinitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139732563) has the molecular formula C35H10BF20N3 and a molecular weight of 863.26 g/mol. Its IUPAC name is 2-(1-pyridin-1-ium-1-ylpropan-2-ylidene)propanedinitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(1-pyridin-1-ium-1-ylpropan-2-ylidene)propanedinitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139732563 |
| Molecular Formula | C35H10BF20N3 |
| Molecular Weight | 863.26 g/mol |
| Exact Mass | 863.06 |
| IUPAC Name | 2-(1-pyridin-1-ium-1-ylpropan-2-ylidene)propanedinitrile;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C[n+]1ccccc1)=C(C#N)C#N.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C11H10N3/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-10(11(7-12)8-13)9-14-5-3-2-4-6-14/h;2-6H,9H2,1H3/q-1;+1 |
| InChIKey | UVTINOUNSUZICS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 51.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.26 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|