C30H7BF21NO — CID 139731566
1-(fluoromethoxy)pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139731566) has the molecular formula C30H7BF21NO and a molecular weight of 807.16 g/mol. Its IUPAC name is 1-(fluoromethoxy)pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-(fluoromethoxy)pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139731566 |
| Molecular Formula | C30H7BF21NO |
| Molecular Weight | 807.16 g/mol |
| Exact Mass | 807.03 |
| IUPAC Name | 1-(fluoromethoxy)pyridin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | FCO[n+]1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C6H7FNO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;7-6-9-8-4-2-1-3-5-8/h;1-5H,6H2/q-1;+1 |
| InChIKey | JRVTXMHJTZEBHP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.16 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|