C18HBF15O- — CID 5246620
hydroxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 5246620) has the molecular formula C18HBF15O- and a molecular weight of 528.99 g/mol. Its IUPAC name is hydroxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | hydroxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 5246620 |
| Molecular Formula | C18HBF15O- |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.99 |
| IUPAC Name | hydroxy-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | O[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18HBF15O/c20-4-1(5(21)11(27)16(32)10(4)26)19(35,2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25/h35H/q-1 |
| InChIKey | WNGLVDXAGJCCKH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|