C22H8BF15O — CID 139103066
oxolan-1-ium-1-yl-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139103066) has the molecular formula C22H8BF15O and a molecular weight of 584.09 g/mol. Its IUPAC name is oxolan-1-ium-1-yl-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | oxolan-1-ium-1-yl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139103066 |
| Molecular Formula | C22H8BF15O |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | oxolan-1-ium-1-yl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[O+]2CCCC2)c(F)c1F |
| InChI | InChI=1S/C22H8BF15O/c24-8-5(9(25)15(31)20(36)14(8)30)23(39-3-1-2-4-39,6-10(26)16(32)21(37)17(33)11(6)27)7-12(28)18(34)22(38)19(35)13(7)29/h1-4H2 |
| InChIKey | AENYJENGLBVNMJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|