About CID 174813685
CID 174813685 (PubChem CID 174813685) has the molecular formula C10AlF7
and a molecular weight of 280.08 g/mol.
Molecular Properties
| Compound Name | CID 174813685 |
| PubChem CID | 174813685 |
| Molecular Formula | C10AlF7 |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c2c([Al])c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C10F7.Al/c11-3-1-2-4(7(14)6(3)13)8(15)10(17)9(16)5(2)12; |
| InChIKey | JGUWGBFMSXUNFO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174813685 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174813685?
The IUPAC name of CID 174813685 (CID 174813685) is not available.
What is the SMILES notation for CID 174813685?
The canonical SMILES for CID 174813685 is Fc1c(F)c(F)c2c([Al])c(F)c(F)c(F)c2c1F.
What is the InChIKey of CID 174813685?
The InChIKey is JGUWGBFMSXUNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10F7.Al/c11-3-1-2-4(7(14)6(3)13)8(15)10(17)9(16)5(2)12;.
What are the key properties of CID 174813685?
CID 174813685 has a molecular weight of 280.08 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174813685 is sourced from PubChem (CID 174813685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).