C20HF13 — CID 71326789
1,2,3,4,5,6,7-heptafluoro-8-(3,4,5,6,7,8-hexafluoronaphthalen-1-yl)naphthalene (PubChem CID 71326789) has the molecular formula C20HF13 and a molecular weight of 488.20 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptafluoro-8-(3,4,5,6,7,8-hexafluoronaphthalen-1-yl)naphthalene.
| Compound Name | 1,2,3,4,5,6,7-heptafluoro-8-(3,4,5,6,7,8-hexafluoronaphthalen-1-yl)naphthalene |
|---|---|
| PubChem CID | 71326789 |
| Molecular Formula | C20HF13 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 1,2,3,4,5,6,7-heptafluoro-8-(3,4,5,6,7,8-hexafluoronaphthalen-1-yl)naphthalene |
| SMILES | Fc1cc(-c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C20HF13/c21-3-1-2(5-7(9(3)22)13(26)19(32)17(30)11(5)24)4-6-8(14(27)16(29)10(4)23)15(28)20(33)18(31)12(6)25/h1H |
| InChIKey | DEKQJDCYOJVRGE-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|