C18H10F7N — CID 175026996
4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-2,3-dimethylaniline (PubChem CID 175026996) has the molecular formula C18H10F7N and a molecular weight of 373.27 g/mol. Its IUPAC name is 4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-2,3-dimethylaniline.
| Compound Name | 4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-2,3-dimethylaniline |
|---|---|
| PubChem CID | 175026996 |
| Molecular Formula | C18H10F7N |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)-2,3-dimethylaniline |
| SMILES | Cc1c(N)ccc(-c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c1C |
| InChI | InChI=1S/C18H10F7N/c1-5-6(2)8(26)4-3-7(5)9-10-11(14(21)16(23)12(9)19)15(22)18(25)17(24)13(10)20/h3-4H,26H2,1-2H3 |
| InChIKey | MGYWAACAMYIXHT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|