C10H14N2O4 — CID 70167322
2,3-dimethylbenzene-1,4-diamine;oxalic acid (PubChem CID 70167322) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,3-dimethylbenzene-1,4-diamine;oxalic acid.
| Compound Name | 2,3-dimethylbenzene-1,4-diamine;oxalic acid |
|---|---|
| PubChem CID | 70167322 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,3-dimethylbenzene-1,4-diamine;oxalic acid |
| SMILES | Cc1c(N)ccc(N)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H12N2.C2H2O4/c1-5-6(2)8(10)4-3-7(5)9;3-1(4)2(5)6/h3-4H,9-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LVCVPPWOGBTGMO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|