C12H17NO2 — CID 174509771
propan-2-yl 4-amino-2,3-dimethylbenzoate (PubChem CID 174509771) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is propan-2-yl 4-amino-2,3-dimethylbenzoate.
| Compound Name | propan-2-yl 4-amino-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 174509771 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | propan-2-yl 4-amino-2,3-dimethylbenzoate |
| SMILES | Cc1c(N)ccc(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C12H17NO2/c1-7(2)15-12(14)10-5-6-11(13)9(4)8(10)3/h5-7H,13H2,1-4H3 |
| InChIKey | XKYPITMGZAWYDO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|