C16H20N4O2 — CID 70386700
benzene-1,4-dicarboxamide;2,4-dimethylbenzene-1,3-diamine (PubChem CID 70386700) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;2,4-dimethylbenzene-1,3-diamine.
| Compound Name | benzene-1,4-dicarboxamide;2,4-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 70386700 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | benzene-1,4-dicarboxamide;2,4-dimethylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)c(C)c1N.NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C8H8N2O2.C8H12N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;1-5-3-4-7(9)6(2)8(5)10/h1-4H,(H2,9,11)(H2,10,12);3-4H,9-10H2,1-2H3 |
| InChIKey | HNKAUMXVSRTERQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|