C16H16N2O3 — CID 61321139
(4-carbamoylphenyl)methyl 3-amino-2-methylbenzoate (PubChem CID 61321139) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl 3-amino-2-methylbenzoate.
| Compound Name | (4-carbamoylphenyl)methyl 3-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 61321139 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (4-carbamoylphenyl)methyl 3-amino-2-methylbenzoate |
| SMILES | Cc1c(N)cccc1C(=O)OCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-13(3-2-4-14(10)17)16(20)21-9-11-5-7-12(8-6-11)15(18)19/h2-8H,9,17H2,1H3,(H2,18,19) |
| InChIKey | DVHRGZILPRCCAX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|