C24H37NO — CID 143814051
heptane;4-methylbenzamide;1,2,4-trimethylbenzene (PubChem CID 143814051) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is heptane;4-methylbenzamide;1,2,4-trimethylbenzene.
| Compound Name | heptane;4-methylbenzamide;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143814051 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | heptane;4-methylbenzamide;1,2,4-trimethylbenzene |
| SMILES | CCCCCCC.Cc1ccc(C(N)=O)cc1.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.C8H9NO.C7H16/c1-7-4-5-8(2)9(3)6-7;1-6-2-4-7(5-3-6)8(9)10;1-3-5-7-6-4-2/h4-6H,1-3H3;2-5H,1H3,(H2,9,10);3-7H2,1-2H3 |
| InChIKey | JAZPRPQLSZBVBS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|