C25F17N — CID 102071858
3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)benzonitrile (PubChem CID 102071858) has the molecular formula C25F17N and a molecular weight of 637.25 g/mol. Its IUPAC name is 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)benzonitrile.
| Compound Name | 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 102071858 |
| Molecular Formula | C25F17N |
| Molecular Weight | 637.25 g/mol |
| Exact Mass | 636.98 |
| IUPAC Name | 3,5-difluoro-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)benzonitrile |
| SMILES | N#Cc1c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25F17N/c26-9-3(5-11(28)17(34)23(40)18(35)12(5)29)2(1-43)4(6-13(30)19(36)24(41)20(37)14(6)31)10(27)7(9)8-15(32)21(38)25(42)22(39)16(8)33 |
| InChIKey | XXAVNDBWURRQSL-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.25 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|