C16F4N4S2 — CID 11610768
1,4,6,9-tetrafluorothianthrene-2,3,7,8-tetracarbonitrile (PubChem CID 11610768) has the molecular formula C16F4N4S2 and a molecular weight of 388.33 g/mol. Its IUPAC name is 1,4,6,9-tetrafluorothianthrene-2,3,7,8-tetracarbonitrile.
| Compound Name | 1,4,6,9-tetrafluorothianthrene-2,3,7,8-tetracarbonitrile |
|---|---|
| PubChem CID | 11610768 |
| Molecular Formula | C16F4N4S2 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 1,4,6,9-tetrafluorothianthrene-2,3,7,8-tetracarbonitrile |
| SMILES | N#Cc1c(F)c2c(c(F)c1C#N)Sc1c(F)c(C#N)c(C#N)c(F)c1S2 |
| InChI | InChI=1S/C16F4N4S2/c17-9-5(1-21)6(2-22)10(18)14-13(9)25-15-11(19)7(3-23)8(4-24)12(20)16(15)26-14 |
| InChIKey | SDAHODWZMLJVAI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |