C10H6F3N3 — CID 14721249
4-(dimethylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 14721249) has the molecular formula C10H6F3N3 and a molecular weight of 225.17 g/mol. Its IUPAC name is 4-(dimethylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 4-(dimethylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 14721249 |
| Molecular Formula | C10H6F3N3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 4-(dimethylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | CN(C)c1c(F)c(F)c(C#N)c(C#N)c1F |
| InChI | InChI=1S/C10H6F3N3/c1-16(2)10-8(12)6(4-15)5(3-14)7(11)9(10)13/h1-2H3 |
| InChIKey | MNMHXZWADGDHBM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|