C12H6Cl2N2 — CID 133095092
3-(3,4-dichlorophenyl)pyridine-2-carbonitrile (PubChem CID 133095092) has the molecular formula C12H6Cl2N2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)pyridine-2-carbonitrile.
| Compound Name | 3-(3,4-dichlorophenyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133095092 |
| Molecular Formula | C12H6Cl2N2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 3-(3,4-dichlorophenyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H6Cl2N2/c13-10-4-3-8(6-11(10)14)9-2-1-5-16-12(9)7-15/h1-6H |
| InChIKey | AFBJJQQCYXNFBD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |